C12H9F7O2 — CID 134631817
ethyl 2-[5-fluoro-2,4-bis(trifluoromethyl)phenyl]acetate (PubChem CID 134631817) has the molecular formula C12H9F7O2 and a molecular weight of 318.19 g/mol. Its IUPAC name is ethyl 2-[5-fluoro-2,4-bis(trifluoromethyl)phenyl]acetate.
| Compound Name | ethyl 2-[5-fluoro-2,4-bis(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 134631817 |
| Molecular Formula | C12H9F7O2 |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | ethyl 2-[5-fluoro-2,4-bis(trifluoromethyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(F)c(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C12H9F7O2/c1-2-21-10(20)4-6-3-9(13)8(12(17,18)19)5-7(6)11(14,15)16/h3,5H,2,4H2,1H3 |
| InChIKey | VOYNFIWLRQKUMX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |