C21H13F6NO2 — CID 134634052
methyl 2,6-bis[4-(trifluoromethyl)phenyl]pyridine-4-carboxylate (PubChem CID 134634052) has the molecular formula C21H13F6NO2 and a molecular weight of 425.33 g/mol. Its IUPAC name is methyl 2,6-bis[4-(trifluoromethyl)phenyl]pyridine-4-carboxylate.
| Compound Name | methyl 2,6-bis[4-(trifluoromethyl)phenyl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 134634052 |
| Molecular Formula | C21H13F6NO2 |
| Molecular Weight | 425.33 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | methyl 2,6-bis[4-(trifluoromethyl)phenyl]pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccc(C(F)(F)F)cc2)nc(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C21H13F6NO2/c1-30-19(29)14-10-17(12-2-6-15(7-3-12)20(22,23)24)28-18(11-14)13-4-8-16(9-5-13)21(25,26)27/h2-11H,1H3 |
| InChIKey | LUDOJLFORSFQJD-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.33 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |