C12H7Cl3O2S — CID 134634500
methyl 3-(2,4,5-trichlorophenyl)thiophene-2-carboxylate (PubChem CID 134634500) has the molecular formula C12H7Cl3O2S and a molecular weight of 321.61 g/mol. Its IUPAC name is methyl 3-(2,4,5-trichlorophenyl)thiophene-2-carboxylate.
| Compound Name | methyl 3-(2,4,5-trichlorophenyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 134634500 |
| Molecular Formula | C12H7Cl3O2S |
| Molecular Weight | 321.61 g/mol |
| Exact Mass | 319.92 |
| IUPAC Name | methyl 3-(2,4,5-trichlorophenyl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1-c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H7Cl3O2S/c1-17-12(16)11-6(2-3-18-11)7-4-9(14)10(15)5-8(7)13/h2-5H,1H3 |
| InChIKey | CGYMICPMJHPKNY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.61 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|