C15H9F6NO3 — CID 134635369
methyl 5-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyridine-2-carboxylate (PubChem CID 134635369) has the molecular formula C15H9F6NO3 and a molecular weight of 365.23 g/mol. Its IUPAC name is methyl 5-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyridine-2-carboxylate.
| Compound Name | methyl 5-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134635369 |
| Molecular Formula | C15H9F6NO3 |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | methyl 5-[4-(trifluoromethoxy)phenyl]-3-(trifluoromethyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ncc(-c2ccc(OC(F)(F)F)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C15H9F6NO3/c1-24-13(23)12-11(14(16,17)18)6-9(7-22-12)8-2-4-10(5-3-8)25-15(19,20)21/h2-7H,1H3 |
| InChIKey | NEAFELVXMZAYTG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |