C14H11F3N2O2 — CID 134635594
methyl 6-amino-5-[2-(trifluoromethyl)phenyl]pyridine-3-carboxylate (PubChem CID 134635594) has the molecular formula C14H11F3N2O2 and a molecular weight of 296.25 g/mol. Its IUPAC name is methyl 6-amino-5-[2-(trifluoromethyl)phenyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-amino-5-[2-(trifluoromethyl)phenyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134635594 |
| Molecular Formula | C14H11F3N2O2 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | methyl 6-amino-5-[2-(trifluoromethyl)phenyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(N)c(-c2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C14H11F3N2O2/c1-21-13(20)8-6-10(12(18)19-7-8)9-4-2-3-5-11(9)14(15,16)17/h2-7H,1H3,(H2,18,19) |
| InChIKey | OZHWTEBSPQDGJQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |