C12H7Cl3FNO — CID 134636305
[2-fluoro-5-(3,4,5-trichlorophenyl)-4-pyridinyl]methanol (PubChem CID 134636305) has the molecular formula C12H7Cl3FNO and a molecular weight of 306.55 g/mol. Its IUPAC name is [2-fluoro-5-(3,4,5-trichlorophenyl)-4-pyridinyl]methanol.
| Compound Name | [2-fluoro-5-(3,4,5-trichlorophenyl)-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 134636305 |
| Molecular Formula | C12H7Cl3FNO |
| Molecular Weight | 306.55 g/mol |
| Exact Mass | 304.96 |
| IUPAC Name | [2-fluoro-5-(3,4,5-trichlorophenyl)-4-pyridinyl]methanol |
| SMILES | OCc1cc(F)ncc1-c1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H7Cl3FNO/c13-9-1-6(2-10(14)12(9)15)8-4-17-11(16)3-7(8)5-18/h1-4,18H,5H2 |
| InChIKey | LYOGPRXORZIMIM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|