About 3-chloro-5-(2,3,5-trichlorophenyl)pyridine-2-carbaldehyde
3-chloro-5-(2,3,5-trichlorophenyl)pyridine-2-carbaldehyde (PubChem CID 134637334) has the molecular formula C12H5Cl4NO
and a molecular weight of 320.99 g/mol. Its IUPAC name is 3-chloro-5-(2,3,5-trichlorophenyl)pyridine-2-carbaldehyde.
Molecular Properties
| Compound Name | 3-chloro-5-(2,3,5-trichlorophenyl)pyridine-2-carbaldehyde |
| PubChem CID | 134637334 |
| Molecular Formula | C12H5Cl4NO |
| Molecular Weight | 320.99 g/mol |
| Exact Mass | 318.91 |
| IUPAC Name | 3-chloro-5-(2,3,5-trichlorophenyl)pyridine-2-carbaldehyde |
| SMILES | O=Cc1ncc(-c2cc(Cl)cc(Cl)c2Cl)cc1Cl |
| InChI | InChI=1S/C12H5Cl4NO/c13-7-2-8(12(16)10(15)3-7)6-1-9(14)11(5-18)17-4-6/h1-5H |
| InChIKey | QGBKROUCZBPKPC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.99 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-5-(2,3,5-trichlorophenyl)pyridine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-(2,3,5-trichlorophenyl)pyridine-2-carbaldehyde?
The IUPAC name of 3-chloro-5-(2,3,5-trichlorophenyl)pyridine-2-carbaldehyde (CID 134637334) is 3-chloro-5-(2,3,5-trichlorophenyl)pyridine-2-carbaldehyde.
What is the SMILES notation for 3-chloro-5-(2,3,5-trichlorophenyl)pyridine-2-carbaldehyde?
The canonical SMILES for 3-chloro-5-(2,3,5-trichlorophenyl)pyridine-2-carbaldehyde is O=Cc1ncc(-c2cc(Cl)cc(Cl)c2Cl)cc1Cl.
What is the InChIKey of 3-chloro-5-(2,3,5-trichlorophenyl)pyridine-2-carbaldehyde?
The InChIKey is QGBKROUCZBPKPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5Cl4NO/c13-7-2-8(12(16)10(15)3-7)6-1-9(14)11(5-18)17-4-6/h1-5H.
What are the key properties of 3-chloro-5-(2,3,5-trichlorophenyl)pyridine-2-carbaldehyde?
3-chloro-5-(2,3,5-trichlorophenyl)pyridine-2-carbaldehyde has a molecular weight of 320.99 g/mol, XLogP of 5.17, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-(2,3,5-trichlorophenyl)pyridine-2-carbaldehyde is sourced from PubChem (CID 134637334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).