C11H4Cl3FIN — CID 134637480
2-fluoro-4-iodo-3-(2,3,5-trichlorophenyl)pyridine (PubChem CID 134637480) has the molecular formula C11H4Cl3FIN and a molecular weight of 402.42 g/mol. Its IUPAC name is 2-fluoro-4-iodo-3-(2,3,5-trichlorophenyl)pyridine.
| Compound Name | 2-fluoro-4-iodo-3-(2,3,5-trichlorophenyl)pyridine |
|---|---|
| PubChem CID | 134637480 |
| Molecular Formula | C11H4Cl3FIN |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 400.84 |
| IUPAC Name | 2-fluoro-4-iodo-3-(2,3,5-trichlorophenyl)pyridine |
| SMILES | Fc1nccc(I)c1-c1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C11H4Cl3FIN/c12-5-3-6(10(14)7(13)4-5)9-8(16)1-2-17-11(9)15/h1-4H |
| InChIKey | XVWIJEWJGJMMSA-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|