About 2,5-bis(2,4,6-trichlorophenyl)pyridine-3-carbaldehyde
2,5-bis(2,4,6-trichlorophenyl)pyridine-3-carbaldehyde (PubChem CID 134637848) has the molecular formula C18H7Cl6NO
and a molecular weight of 465.98 g/mol. Its IUPAC name is 2,5-bis(2,4,6-trichlorophenyl)pyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | 2,5-bis(2,4,6-trichlorophenyl)pyridine-3-carbaldehyde |
| PubChem CID | 134637848 |
| Molecular Formula | C18H7Cl6NO |
| Molecular Weight | 465.98 g/mol |
| Exact Mass | 462.87 |
| IUPAC Name | 2,5-bis(2,4,6-trichlorophenyl)pyridine-3-carbaldehyde |
| SMILES | O=Cc1cc(-c2c(Cl)cc(Cl)cc2Cl)cnc1-c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C18H7Cl6NO/c19-10-2-12(21)16(13(22)3-10)8-1-9(7-26)18(25-6-8)17-14(23)4-11(20)5-15(17)24/h1-7H |
| InChIKey | RNZBAQMOOMUJFN-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.98 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis(2,4,6-trichlorophenyl)pyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(2,4,6-trichlorophenyl)pyridine-3-carbaldehyde?
The IUPAC name of 2,5-bis(2,4,6-trichlorophenyl)pyridine-3-carbaldehyde (CID 134637848) is 2,5-bis(2,4,6-trichlorophenyl)pyridine-3-carbaldehyde.
What is the SMILES notation for 2,5-bis(2,4,6-trichlorophenyl)pyridine-3-carbaldehyde?
The canonical SMILES for 2,5-bis(2,4,6-trichlorophenyl)pyridine-3-carbaldehyde is O=Cc1cc(-c2c(Cl)cc(Cl)cc2Cl)cnc1-c1c(Cl)cc(Cl)cc1Cl.
What is the InChIKey of 2,5-bis(2,4,6-trichlorophenyl)pyridine-3-carbaldehyde?
The InChIKey is RNZBAQMOOMUJFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H7Cl6NO/c19-10-2-12(21)16(13(22)3-10)8-1-9(7-26)18(25-6-8)17-14(23)4-11(20)5-15(17)24/h1-7H.
What are the key properties of 2,5-bis(2,4,6-trichlorophenyl)pyridine-3-carbaldehyde?
2,5-bis(2,4,6-trichlorophenyl)pyridine-3-carbaldehyde has a molecular weight of 465.98 g/mol, XLogP of 8.15, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(2,4,6-trichlorophenyl)pyridine-3-carbaldehyde is sourced from PubChem (CID 134637848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).