C10H5F6IO2 — CID 134638367
methyl 3-iodo-2,4-bis(trifluoromethyl)benzoate (PubChem CID 134638367) has the molecular formula C10H5F6IO2 and a molecular weight of 398.04 g/mol. Its IUPAC name is methyl 3-iodo-2,4-bis(trifluoromethyl)benzoate.
| Compound Name | methyl 3-iodo-2,4-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 134638367 |
| Molecular Formula | C10H5F6IO2 |
| Molecular Weight | 398.04 g/mol |
| Exact Mass | 397.92 |
| IUPAC Name | methyl 3-iodo-2,4-bis(trifluoromethyl)benzoate |
| SMILES | COC(=O)c1ccc(C(F)(F)F)c(I)c1C(F)(F)F |
| InChI | InChI=1S/C10H5F6IO2/c1-19-8(18)4-2-3-5(9(11,12)13)7(17)6(4)10(14,15)16/h2-3H,1H3 |
| InChIKey | CDLIHVGIYHAALS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.04 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|