About [3-amino-2,4-bis(trifluoromethyl)phenyl]methanol
[3-amino-2,4-bis(trifluoromethyl)phenyl]methanol (PubChem CID 134638774) has the molecular formula C9H7F6NO
and a molecular weight of 259.15 g/mol. Its IUPAC name is [3-amino-2,4-bis(trifluoromethyl)phenyl]methanol.
Molecular Properties
| Compound Name | [3-amino-2,4-bis(trifluoromethyl)phenyl]methanol |
| PubChem CID | 134638774 |
| Molecular Formula | C9H7F6NO |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | [3-amino-2,4-bis(trifluoromethyl)phenyl]methanol |
| SMILES | Nc1c(C(F)(F)F)ccc(CO)c1C(F)(F)F |
| InChI | InChI=1S/C9H7F6NO/c10-8(11,12)5-2-1-4(3-17)6(7(5)16)9(13,14)15/h1-2,17H,3,16H2 |
| InChIKey | BCBDIJPMCOGXTM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [3-amino-2,4-bis(trifluoromethyl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-amino-2,4-bis(trifluoromethyl)phenyl]methanol?
The IUPAC name of [3-amino-2,4-bis(trifluoromethyl)phenyl]methanol (CID 134638774) is [3-amino-2,4-bis(trifluoromethyl)phenyl]methanol.
What is the SMILES notation for [3-amino-2,4-bis(trifluoromethyl)phenyl]methanol?
The canonical SMILES for [3-amino-2,4-bis(trifluoromethyl)phenyl]methanol is Nc1c(C(F)(F)F)ccc(CO)c1C(F)(F)F.
What is the InChIKey of [3-amino-2,4-bis(trifluoromethyl)phenyl]methanol?
The InChIKey is BCBDIJPMCOGXTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F6NO/c10-8(11,12)5-2-1-4(3-17)6(7(5)16)9(13,14)15/h1-2,17H,3,16H2.
What are the key properties of [3-amino-2,4-bis(trifluoromethyl)phenyl]methanol?
[3-amino-2,4-bis(trifluoromethyl)phenyl]methanol has a molecular weight of 259.15 g/mol, XLogP of 2.80, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-amino-2,4-bis(trifluoromethyl)phenyl]methanol is sourced from PubChem (CID 134638774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).