C9H5BrF6O — CID 134638808
[4-bromo-3,5-bis(trifluoromethyl)phenyl]methanol (PubChem CID 134638808) has the molecular formula C9H5BrF6O and a molecular weight of 323.03 g/mol. Its IUPAC name is [4-bromo-3,5-bis(trifluoromethyl)phenyl]methanol.
| Compound Name | [4-bromo-3,5-bis(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 134638808 |
| Molecular Formula | C9H5BrF6O |
| Molecular Weight | 323.03 g/mol |
| Exact Mass | 321.94 |
| IUPAC Name | [4-bromo-3,5-bis(trifluoromethyl)phenyl]methanol |
| SMILES | OCc1cc(C(F)(F)F)c(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H5BrF6O/c10-7-5(8(11,12)13)1-4(3-17)2-6(7)9(14,15)16/h1-2,17H,3H2 |
| InChIKey | XRRCNQNFLXFFRG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.03 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |