About 8-ethyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-8-ium-7-olate
8-ethyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-8-ium-7-olate (PubChem CID 13463958) has the molecular formula C8H8N2O2S
and a molecular weight of 196.23 g/mol. Its IUPAC name is 8-ethyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-8-ium-7-olate.
Molecular Properties
| Compound Name | 8-ethyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-8-ium-7-olate |
| PubChem CID | 13463958 |
| Molecular Formula | C8H8N2O2S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 8-ethyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-8-ium-7-olate |
| SMILES | CC[n+]1c([O-])cc(=O)n2ccsc21 |
| InChI | InChI=1S/C8H8N2O2S/c1-2-9-6(11)5-7(12)10-3-4-13-8(9)10/h3-5H,2H2,1H3 |
| InChIKey | UBDHSUAUGXMQIJ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 8-ethyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-8-ium-7-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-8-ium-7-olate?
The IUPAC name of 8-ethyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-8-ium-7-olate (CID 13463958) is 8-ethyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-8-ium-7-olate.
What is the SMILES notation for 8-ethyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-8-ium-7-olate?
The canonical SMILES for 8-ethyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-8-ium-7-olate is CC[n+]1c([O-])cc(=O)n2ccsc21.
What is the InChIKey of 8-ethyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-8-ium-7-olate?
The InChIKey is UBDHSUAUGXMQIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2S/c1-2-9-6(11)5-7(12)10-3-4-13-8(9)10/h3-5H,2H2,1H3.
What are the key properties of 8-ethyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-8-ium-7-olate?
8-ethyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-8-ium-7-olate has a molecular weight of 196.23 g/mol, XLogP of -0.26, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-8-ium-7-olate is sourced from PubChem (CID 13463958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).