C19H23N3 — CID 13464016
N',N'-dimethyl-N-(10-methyl-5-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaen-2-yl)ethane-1,2-diamine (PubChem CID 13464016) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is N',N'-dimethyl-N-(10-methyl-5-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaen-2-yl)ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-(10-methyl-5-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaen-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 13464016 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | N',N'-dimethyl-N-(10-methyl-5-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaen-2-yl)ethane-1,2-diamine |
| SMILES | CC1=Cc2ccncc2C(NCCN(C)C)c2ccccc21 |
| InChI | InChI=1S/C19H23N3/c1-14-12-15-8-9-20-13-18(15)19(21-10-11-22(2)3)17-7-5-4-6-16(14)17/h4-9,12-13,19,21H,10-11H2,1-3H3 |
| InChIKey | KMZQGAUCZZOOQJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |