C15H16O6 — CID 134642391
3-[3-[(E)-2-carboxyethenyl]-4-ethoxycarbonylphenyl]propanoic acid (PubChem CID 134642391) has the molecular formula C15H16O6 and a molecular weight of 292.29 g/mol. Its IUPAC name is 3-[3-[(E)-2-carboxyethenyl]-4-ethoxycarbonylphenyl]propanoic acid.
| Compound Name | 3-[3-[(E)-2-carboxyethenyl]-4-ethoxycarbonylphenyl]propanoic acid |
|---|---|
| PubChem CID | 134642391 |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 3-[3-[(E)-2-carboxyethenyl]-4-ethoxycarbonylphenyl]propanoic acid |
| SMILES | CCOC(=O)c1ccc(CCC(=O)O)cc1/C=C/C(=O)O |
| InChI | InChI=1S/C15H16O6/c1-2-21-15(20)12-6-3-10(4-7-13(16)17)9-11(12)5-8-14(18)19/h3,5-6,8-9H,2,4,7H2,1H3,(H,16,17)(H,18,19)/b8-5+ |
| InChIKey | YFYZMJMJQMFLQY-VMPITWQZSA-N |
| XLogP | 1.98 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|