C8H5F11O2 — CID 13464242
2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-(1,1,2,2,2-pentafluoroethyl)-1,3-dioxolane (PubChem CID 13464242) has the molecular formula C8H5F11O2 and a molecular weight of 342.10 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-(1,1,2,2,2-pentafluoroethyl)-1,3-dioxolane.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-(1,1,2,2,2-pentafluoroethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 13464242 |
| Molecular Formula | C8H5F11O2 |
| Molecular Weight | 342.10 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-(1,1,2,2,2-pentafluoroethyl)-1,3-dioxolane |
| SMILES | FC(F)(F)C(C(F)(F)F)C1(C(F)(F)C(F)(F)F)OCCO1 |
| InChI | InChI=1S/C8H5F11O2/c9-5(10,11)3(6(12,13)14)4(20-1-2-21-4)7(15,16)8(17,18)19/h3H,1-2H2 |
| InChIKey | ZBKMMWFJQHROEC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.10 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|