C13H13BrF2O4 — CID 134643050
ethyl 5-(3-bromo-2-oxopropyl)-2-(difluoromethoxy)benzoate (PubChem CID 134643050) has the molecular formula C13H13BrF2O4 and a molecular weight of 351.14 g/mol. Its IUPAC name is ethyl 5-(3-bromo-2-oxopropyl)-2-(difluoromethoxy)benzoate.
| Compound Name | ethyl 5-(3-bromo-2-oxopropyl)-2-(difluoromethoxy)benzoate |
|---|---|
| PubChem CID | 134643050 |
| Molecular Formula | C13H13BrF2O4 |
| Molecular Weight | 351.14 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | ethyl 5-(3-bromo-2-oxopropyl)-2-(difluoromethoxy)benzoate |
| SMILES | CCOC(=O)c1cc(CC(=O)CBr)ccc1OC(F)F |
| InChI | InChI=1S/C13H13BrF2O4/c1-2-19-12(18)10-6-8(5-9(17)7-14)3-4-11(10)20-13(15)16/h3-4,6,13H,2,5,7H2,1H3 |
| InChIKey | INZHOBFOGPXCQM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.14 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|