C12H10F3NO3S — CID 134643410
ethyl 3-cyano-2-(hydroxymethyl)-4-(trifluoromethylsulfanyl)benzoate (PubChem CID 134643410) has the molecular formula C12H10F3NO3S and a molecular weight of 305.28 g/mol. Its IUPAC name is ethyl 3-cyano-2-(hydroxymethyl)-4-(trifluoromethylsulfanyl)benzoate.
| Compound Name | ethyl 3-cyano-2-(hydroxymethyl)-4-(trifluoromethylsulfanyl)benzoate |
|---|---|
| PubChem CID | 134643410 |
| Molecular Formula | C12H10F3NO3S |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | ethyl 3-cyano-2-(hydroxymethyl)-4-(trifluoromethylsulfanyl)benzoate |
| SMILES | CCOC(=O)c1ccc(SC(F)(F)F)c(C#N)c1CO |
| InChI | InChI=1S/C12H10F3NO3S/c1-2-19-11(18)7-3-4-10(20-12(13,14)15)8(5-16)9(7)6-17/h3-4,17H,2,6H2,1H3 |
| InChIKey | ZYTZWRILSPFKAA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |