methyl 2-cyano-5-(difluoromethoxy)-4-formylbenzoate

C11H7F2NO4 — CID 134646562

IUPACmethyl 2-cyano-5-(difluoromethoxy)-4-formylbenzoate
SMILESCOC(=O)c1cc(OC(F)F)c(C=O)cc1C#N
InChIInChI=1S/C11H7F2NO4/c1-17-10(16)8-3-9(18-11(12)13)7(5-15)2-6(8)4-14/h2-3,5,11H,1H3
InChIKeyQSZVOKNWCOZKAI-UHFFFAOYSA-N
MW255.18 g/mol
LogP1.76
Rot. Bonds4

About methyl 2-cyano-5-(difluoromethoxy)-4-formylbenzoate

methyl 2-cyano-5-(difluoromethoxy)-4-formylbenzoate (PubChem CID 134646562) has the molecular formula C11H7F2NO4 and a molecular weight of 255.18 g/mol. Its IUPAC name is methyl 2-cyano-5-(difluoromethoxy)-4-formylbenzoate.

Molecular Properties

Compound Namemethyl 2-cyano-5-(difluoromethoxy)-4-formylbenzoate
PubChem CID134646562
Molecular FormulaC11H7F2NO4
Molecular Weight255.18 g/mol
Exact Mass255.03
IUPAC Namemethyl 2-cyano-5-(difluoromethoxy)-4-formylbenzoate
SMILESCOC(=O)c1cc(OC(F)F)c(C=O)cc1C#N
InChIInChI=1S/C11H7F2NO4/c1-17-10(16)8-3-9(18-11(12)13)7(5-15)2-6(8)4-14/h2-3,5,11H,1H3
InChIKeyQSZVOKNWCOZKAI-UHFFFAOYSA-N
XLogP1.76
TPSA76.39 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.18
LogP ≤ 51.76
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze methyl 2-cyano-5-(difluoromethoxy)-4-formylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-cyano-5-(difluoromethoxy)-4-formylbenzoate?
The IUPAC name of methyl 2-cyano-5-(difluoromethoxy)-4-formylbenzoate (CID 134646562) is methyl 2-cyano-5-(difluoromethoxy)-4-formylbenzoate.
What is the SMILES notation for methyl 2-cyano-5-(difluoromethoxy)-4-formylbenzoate?
The canonical SMILES for methyl 2-cyano-5-(difluoromethoxy)-4-formylbenzoate is COC(=O)c1cc(OC(F)F)c(C=O)cc1C#N.
What is the InChIKey of methyl 2-cyano-5-(difluoromethoxy)-4-formylbenzoate?
The InChIKey is QSZVOKNWCOZKAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7F2NO4/c1-17-10(16)8-3-9(18-11(12)13)7(5-15)2-6(8)4-14/h2-3,5,11H,1H3.
What are the key properties of methyl 2-cyano-5-(difluoromethoxy)-4-formylbenzoate?
methyl 2-cyano-5-(difluoromethoxy)-4-formylbenzoate has a molecular weight of 255.18 g/mol, XLogP of 1.76, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-cyano-5-(difluoromethoxy)-4-formylbenzoate is sourced from PubChem (CID 134646562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).