C10H7F3N2O3 — CID 134651948
6-(aminomethyl)-3-cyano-2-(trifluoromethoxy)benzoic acid (PubChem CID 134651948) has the molecular formula C10H7F3N2O3 and a molecular weight of 260.17 g/mol. Its IUPAC name is 6-(aminomethyl)-3-cyano-2-(trifluoromethoxy)benzoic acid.
| Compound Name | 6-(aminomethyl)-3-cyano-2-(trifluoromethoxy)benzoic acid |
|---|---|
| PubChem CID | 134651948 |
| Molecular Formula | C10H7F3N2O3 |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 6-(aminomethyl)-3-cyano-2-(trifluoromethoxy)benzoic acid |
| SMILES | N#Cc1ccc(CN)c(C(=O)O)c1OC(F)(F)F |
| InChI | InChI=1S/C10H7F3N2O3/c11-10(12,13)18-8-6(4-15)2-1-5(3-14)7(8)9(16)17/h1-2H,3,14H2,(H,16,17) |
| InChIKey | RTMSHULGBUNCKL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |