C14H15NO4 — CID 134653422
3-[3-cyano-5-(2-ethoxy-2-oxoethyl)phenyl]propanoic acid (PubChem CID 134653422) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 3-[3-cyano-5-(2-ethoxy-2-oxoethyl)phenyl]propanoic acid.
| Compound Name | 3-[3-cyano-5-(2-ethoxy-2-oxoethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 134653422 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 3-[3-cyano-5-(2-ethoxy-2-oxoethyl)phenyl]propanoic acid |
| SMILES | CCOC(=O)Cc1cc(C#N)cc(CCC(=O)O)c1 |
| InChI | InChI=1S/C14H15NO4/c1-2-19-14(18)8-11-5-10(3-4-13(16)17)6-12(7-11)9-15/h5-7H,2-4,8H2,1H3,(H,16,17) |
| InChIKey | IOGVXDXLPLBPPX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |