C12H9F3N2O4S — CID 134654029
ethyl 2-[2-cyano-5-nitro-3-(trifluoromethylsulfanyl)phenyl]acetate (PubChem CID 134654029) has the molecular formula C12H9F3N2O4S and a molecular weight of 334.28 g/mol. Its IUPAC name is ethyl 2-[2-cyano-5-nitro-3-(trifluoromethylsulfanyl)phenyl]acetate.
| Compound Name | ethyl 2-[2-cyano-5-nitro-3-(trifluoromethylsulfanyl)phenyl]acetate |
|---|---|
| PubChem CID | 134654029 |
| Molecular Formula | C12H9F3N2O4S |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | ethyl 2-[2-cyano-5-nitro-3-(trifluoromethylsulfanyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1cc([N+](=O)[O-])cc(SC(F)(F)F)c1C#N |
| InChI | InChI=1S/C12H9F3N2O4S/c1-2-21-11(18)4-7-3-8(17(19)20)5-10(9(7)6-16)22-12(13,14)15/h3,5H,2,4H2,1H3 |
| InChIKey | YDUWCFGQTNHSIB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 93.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|