C12H11ClO5 — CID 134657212
2-[3-(3-chloropropanoyl)-4-formylphenyl]-2-hydroxyacetic acid (PubChem CID 134657212) has the molecular formula C12H11ClO5 and a molecular weight of 270.67 g/mol. Its IUPAC name is 2-[3-(3-chloropropanoyl)-4-formylphenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[3-(3-chloropropanoyl)-4-formylphenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 134657212 |
| Molecular Formula | C12H11ClO5 |
| Molecular Weight | 270.67 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 2-[3-(3-chloropropanoyl)-4-formylphenyl]-2-hydroxyacetic acid |
| SMILES | O=Cc1ccc(C(O)C(=O)O)cc1C(=O)CCCl |
| InChI | InChI=1S/C12H11ClO5/c13-4-3-10(15)9-5-7(11(16)12(17)18)1-2-8(9)6-14/h1-2,5-6,11,16H,3-4H2,(H,17,18) |
| InChIKey | FMAATLZCLYDCPN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.67 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|