C10H10F3NO4 — CID 134658771
methyl 2-[5-hydroxy-2-methyl-6-(trifluoromethoxy)-3-pyridinyl]acetate (PubChem CID 134658771) has the molecular formula C10H10F3NO4 and a molecular weight of 265.19 g/mol. Its IUPAC name is methyl 2-[5-hydroxy-2-methyl-6-(trifluoromethoxy)-3-pyridinyl]acetate.
| Compound Name | methyl 2-[5-hydroxy-2-methyl-6-(trifluoromethoxy)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 134658771 |
| Molecular Formula | C10H10F3NO4 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | methyl 2-[5-hydroxy-2-methyl-6-(trifluoromethoxy)-3-pyridinyl]acetate |
| SMILES | COC(=O)Cc1cc(O)c(OC(F)(F)F)nc1C |
| InChI | InChI=1S/C10H10F3NO4/c1-5-6(4-8(16)17-2)3-7(15)9(14-5)18-10(11,12)13/h3,15H,4H2,1-2H3 |
| InChIKey | DPQKVNKBDKBCOW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |