About 5-chloro-1H-pyrazolo[1,5-a]pyrimidin-7-one
5-chloro-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 13465974) has the molecular formula C6H4ClN3O
and a molecular weight of 169.57 g/mol. Its IUPAC name is 5-chloro-1H-pyrazolo[1,5-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 5-chloro-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| PubChem CID | 13465974 |
| Molecular Formula | C6H4ClN3O |
| Molecular Weight | 169.57 g/mol |
| Exact Mass | 169.00 |
| IUPAC Name | 5-chloro-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | O=c1cc(Cl)nc2cc[nH]n12 |
| InChI | InChI=1S/C6H4ClN3O/c7-4-3-6(11)10-5(9-4)1-2-8-10/h1-3,8H |
| InChIKey | IYNABQNUIXYONK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.57 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-1H-pyrazolo[1,5-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The IUPAC name of 5-chloro-1H-pyrazolo[1,5-a]pyrimidin-7-one (CID 13465974) is 5-chloro-1H-pyrazolo[1,5-a]pyrimidin-7-one.
What is the SMILES notation for 5-chloro-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The canonical SMILES for 5-chloro-1H-pyrazolo[1,5-a]pyrimidin-7-one is O=c1cc(Cl)nc2cc[nH]n12.
What is the InChIKey of 5-chloro-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The InChIKey is IYNABQNUIXYONK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClN3O/c7-4-3-6(11)10-5(9-4)1-2-8-10/h1-3,8H.
What are the key properties of 5-chloro-1H-pyrazolo[1,5-a]pyrimidin-7-one?
5-chloro-1H-pyrazolo[1,5-a]pyrimidin-7-one has a molecular weight of 169.57 g/mol, XLogP of 0.68, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1H-pyrazolo[1,5-a]pyrimidin-7-one is sourced from PubChem (CID 13465974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).