About 6H-pyrazolo[5,1-c][1,2,4]triazin-4-one
6H-pyrazolo[5,1-c][1,2,4]triazin-4-one (PubChem CID 13465976) has the molecular formula C5H4N4O
and a molecular weight of 136.11 g/mol. Its IUPAC name is 6H-pyrazolo[5,1-c][1,2,4]triazin-4-one.
Molecular Properties
| Compound Name | 6H-pyrazolo[5,1-c][1,2,4]triazin-4-one |
| PubChem CID | 13465976 |
| Molecular Formula | C5H4N4O |
| Molecular Weight | 136.11 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | 6H-pyrazolo[5,1-c][1,2,4]triazin-4-one |
| SMILES | O=c1cnnc2cc[nH]n12 |
| InChI | InChI=1S/C5H4N4O/c10-5-3-6-8-4-1-2-7-9(4)5/h1-3,7H |
| InChIKey | GLVYFVYELPFNQC-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.11 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6H-pyrazolo[5,1-c][1,2,4]triazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-pyrazolo[5,1-c][1,2,4]triazin-4-one?
The IUPAC name of 6H-pyrazolo[5,1-c][1,2,4]triazin-4-one (CID 13465976) is 6H-pyrazolo[5,1-c][1,2,4]triazin-4-one.
What is the SMILES notation for 6H-pyrazolo[5,1-c][1,2,4]triazin-4-one?
The canonical SMILES for 6H-pyrazolo[5,1-c][1,2,4]triazin-4-one is O=c1cnnc2cc[nH]n12.
What is the InChIKey of 6H-pyrazolo[5,1-c][1,2,4]triazin-4-one?
The InChIKey is GLVYFVYELPFNQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4O/c10-5-3-6-8-4-1-2-7-9(4)5/h1-3,7H.
What are the key properties of 6H-pyrazolo[5,1-c][1,2,4]triazin-4-one?
6H-pyrazolo[5,1-c][1,2,4]triazin-4-one has a molecular weight of 136.11 g/mol, XLogP of -0.58, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-pyrazolo[5,1-c][1,2,4]triazin-4-one is sourced from PubChem (CID 13465976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).