C9H9BrF3NO3 — CID 134661940
[5-(bromomethyl)-3-methoxy-2-(trifluoromethoxy)-4-pyridinyl]methanol (PubChem CID 134661940) has the molecular formula C9H9BrF3NO3 and a molecular weight of 316.07 g/mol. Its IUPAC name is [5-(bromomethyl)-3-methoxy-2-(trifluoromethoxy)-4-pyridinyl]methanol.
| Compound Name | [5-(bromomethyl)-3-methoxy-2-(trifluoromethoxy)-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 134661940 |
| Molecular Formula | C9H9BrF3NO3 |
| Molecular Weight | 316.07 g/mol |
| Exact Mass | 314.97 |
| IUPAC Name | [5-(bromomethyl)-3-methoxy-2-(trifluoromethoxy)-4-pyridinyl]methanol |
| SMILES | COc1c(OC(F)(F)F)ncc(CBr)c1CO |
| InChI | InChI=1S/C9H9BrF3NO3/c1-16-7-6(4-15)5(2-10)3-14-8(7)17-9(11,12)13/h3,15H,2,4H2,1H3 |
| InChIKey | FFFXHUAXKGXDHI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.07 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|