About CID 13466318
CID 13466318 (PubChem CID 13466318) has the molecular formula C7H15BN2
and a molecular weight of 138.02 g/mol.
Molecular Properties
| Compound Name | CID 13466318 |
| PubChem CID | 13466318 |
| Molecular Formula | C7H15BN2 |
| Molecular Weight | 138.02 g/mol |
| Exact Mass | 138.13 |
| IUPAC Name | — |
| SMILES | CCN(CC)CC.[B]C#N |
| InChI | InChI=1S/C6H15N.CBN/c1-4-7(5-2)6-3;2-1-3/h4-6H2,1-3H3; |
| InChIKey | MEHBIHOSETYXDX-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.02 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 13466318 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 13466318?
The IUPAC name of CID 13466318 (CID 13466318) is not available.
What is the SMILES notation for CID 13466318?
The canonical SMILES for CID 13466318 is CCN(CC)CC.[B]C#N.
What is the InChIKey of CID 13466318?
The InChIKey is MEHBIHOSETYXDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.CBN/c1-4-7(5-2)6-3;2-1-3/h4-6H2,1-3H3;.
What are the key properties of CID 13466318?
CID 13466318 has a molecular weight of 138.02 g/mol, XLogP of 0.98, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 13466318 is sourced from PubChem (CID 13466318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).