C8H4Cl2F5NO3S — CID 134663474
6-(chloromethyl)-5-(difluoromethyl)-3-(trifluoromethoxy)pyridine-2-sulfonyl chloride (PubChem CID 134663474) has the molecular formula C8H4Cl2F5NO3S and a molecular weight of 360.09 g/mol. Its IUPAC name is 6-(chloromethyl)-5-(difluoromethyl)-3-(trifluoromethoxy)pyridine-2-sulfonyl chloride.
| Compound Name | 6-(chloromethyl)-5-(difluoromethyl)-3-(trifluoromethoxy)pyridine-2-sulfonyl chloride |
|---|---|
| PubChem CID | 134663474 |
| Molecular Formula | C8H4Cl2F5NO3S |
| Molecular Weight | 360.09 g/mol |
| Exact Mass | 358.92 |
| IUPAC Name | 6-(chloromethyl)-5-(difluoromethyl)-3-(trifluoromethoxy)pyridine-2-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1nc(CCl)c(C(F)F)cc1OC(F)(F)F |
| InChI | InChI=1S/C8H4Cl2F5NO3S/c9-2-4-3(6(11)12)1-5(19-8(13,14)15)7(16-4)20(10,17)18/h1,6H,2H2 |
| InChIKey | NECNLDSCIMTTSL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.09 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|