C10H8F5NO2 — CID 134664348
ethyl 3-(difluoromethyl)-5-(trifluoromethyl)pyridine-2-carboxylate (PubChem CID 134664348) has the molecular formula C10H8F5NO2 and a molecular weight of 269.17 g/mol. Its IUPAC name is ethyl 3-(difluoromethyl)-5-(trifluoromethyl)pyridine-2-carboxylate.
| Compound Name | ethyl 3-(difluoromethyl)-5-(trifluoromethyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134664348 |
| Molecular Formula | C10H8F5NO2 |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | ethyl 3-(difluoromethyl)-5-(trifluoromethyl)pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1ncc(C(F)(F)F)cc1C(F)F |
| InChI | InChI=1S/C10H8F5NO2/c1-2-18-9(17)7-6(8(11)12)3-5(4-16-7)10(13,14)15/h3-4,8H,2H2,1H3 |
| InChIKey | LVNKLTBQQRAVKX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |