C8H7F2N3O4 — CID 134664428
methyl 4-amino-2-(difluoromethyl)-5-nitropyridine-3-carboxylate (PubChem CID 134664428) has the molecular formula C8H7F2N3O4 and a molecular weight of 247.16 g/mol. Its IUPAC name is methyl 4-amino-2-(difluoromethyl)-5-nitropyridine-3-carboxylate.
| Compound Name | methyl 4-amino-2-(difluoromethyl)-5-nitropyridine-3-carboxylate |
|---|---|
| PubChem CID | 134664428 |
| Molecular Formula | C8H7F2N3O4 |
| Molecular Weight | 247.16 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | methyl 4-amino-2-(difluoromethyl)-5-nitropyridine-3-carboxylate |
| SMILES | COC(=O)c1c(C(F)F)ncc([N+](=O)[O-])c1N |
| InChI | InChI=1S/C8H7F2N3O4/c1-17-8(14)4-5(11)3(13(15)16)2-12-6(4)7(9)10/h2,7H,1H3,(H2,11,12) |
| InChIKey | SCXWWWINPUNNBI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.16 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|