C8H7F3INO3 — CID 134664598
[3-iodo-4-methoxy-6-(trifluoromethoxy)-2-pyridinyl]methanol (PubChem CID 134664598) has the molecular formula C8H7F3INO3 and a molecular weight of 349.05 g/mol. Its IUPAC name is [3-iodo-4-methoxy-6-(trifluoromethoxy)-2-pyridinyl]methanol.
| Compound Name | [3-iodo-4-methoxy-6-(trifluoromethoxy)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 134664598 |
| Molecular Formula | C8H7F3INO3 |
| Molecular Weight | 349.05 g/mol |
| Exact Mass | 348.94 |
| IUPAC Name | [3-iodo-4-methoxy-6-(trifluoromethoxy)-2-pyridinyl]methanol |
| SMILES | COc1cc(OC(F)(F)F)nc(CO)c1I |
| InChI | InChI=1S/C8H7F3INO3/c1-15-5-2-6(16-8(9,10)11)13-4(3-14)7(5)12/h2,14H,3H2,1H3 |
| InChIKey | XRAVSIBWPWIEQG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.05 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|