C10H12F2N2O2 — CID 134665311
ethyl 2-[6-amino-3-(difluoromethyl)-2-pyridinyl]acetate (PubChem CID 134665311) has the molecular formula C10H12F2N2O2 and a molecular weight of 230.21 g/mol. Its IUPAC name is ethyl 2-[6-amino-3-(difluoromethyl)-2-pyridinyl]acetate.
| Compound Name | ethyl 2-[6-amino-3-(difluoromethyl)-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 134665311 |
| Molecular Formula | C10H12F2N2O2 |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | ethyl 2-[6-amino-3-(difluoromethyl)-2-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1nc(N)ccc1C(F)F |
| InChI | InChI=1S/C10H12F2N2O2/c1-2-16-9(15)5-7-6(10(11)12)3-4-8(13)14-7/h3-4,10H,2,5H2,1H3,(H2,13,14) |
| InChIKey | QQMLONVYSMTHKQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |