C12H17N3O7 — CID 13466644
3,6,9,12,15-pentaoxa-18,19,20-triazabicyclo[15.2.1]icosa-1(20),17-diene-2,16-dione (PubChem CID 13466644) has the molecular formula C12H17N3O7 and a molecular weight of 315.28 g/mol. Its IUPAC name is 3,6,9,12,15-pentaoxa-18,19,20-triazabicyclo[15.2.1]icosa-1(20),17-diene-2,16-dione.
| Compound Name | 3,6,9,12,15-pentaoxa-18,19,20-triazabicyclo[15.2.1]icosa-1(20),17-diene-2,16-dione |
|---|---|
| PubChem CID | 13466644 |
| Molecular Formula | C12H17N3O7 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 3,6,9,12,15-pentaoxa-18,19,20-triazabicyclo[15.2.1]icosa-1(20),17-diene-2,16-dione |
| SMILES | O=C1OCCOCCOCCOCCOC(=O)c2nc1n[nH]2 |
| InChI | InChI=1S/C12H17N3O7/c16-11-9-13-10(15-14-9)12(17)22-8-6-20-4-2-18-1-3-19-5-7-21-11/h1-8H2,(H,13,14,15) |
| InChIKey | UBJOZYNQXUQYLQ-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |