C9H7F2I2NO2 — CID 134668582
methyl 2-[5-(difluoromethyl)-2,3-diiodo-4-pyridinyl]acetate (PubChem CID 134668582) has the molecular formula C9H7F2I2NO2 and a molecular weight of 452.96 g/mol. Its IUPAC name is methyl 2-[5-(difluoromethyl)-2,3-diiodo-4-pyridinyl]acetate.
| Compound Name | methyl 2-[5-(difluoromethyl)-2,3-diiodo-4-pyridinyl]acetate |
|---|---|
| PubChem CID | 134668582 |
| Molecular Formula | C9H7F2I2NO2 |
| Molecular Weight | 452.96 g/mol |
| Exact Mass | 452.85 |
| IUPAC Name | methyl 2-[5-(difluoromethyl)-2,3-diiodo-4-pyridinyl]acetate |
| SMILES | COC(=O)Cc1c(C(F)F)cnc(I)c1I |
| InChI | InChI=1S/C9H7F2I2NO2/c1-16-6(15)2-4-5(8(10)11)3-14-9(13)7(4)12/h3,8H,2H2,1H3 |
| InChIKey | MUMSHFPGYCCAOY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.96 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|