C9H8F3IN2O3 — CID 134668714
methyl 5-(aminomethyl)-4-iodo-6-(trifluoromethoxy)pyridine-2-carboxylate (PubChem CID 134668714) has the molecular formula C9H8F3IN2O3 and a molecular weight of 376.07 g/mol. Its IUPAC name is methyl 5-(aminomethyl)-4-iodo-6-(trifluoromethoxy)pyridine-2-carboxylate.
| Compound Name | methyl 5-(aminomethyl)-4-iodo-6-(trifluoromethoxy)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134668714 |
| Molecular Formula | C9H8F3IN2O3 |
| Molecular Weight | 376.07 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | methyl 5-(aminomethyl)-4-iodo-6-(trifluoromethoxy)pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(I)c(CN)c(OC(F)(F)F)n1 |
| InChI | InChI=1S/C9H8F3IN2O3/c1-17-8(16)6-2-5(13)4(3-14)7(15-6)18-9(10,11)12/h2H,3,14H2,1H3 |
| InChIKey | XATMNXUYIBPXJH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.07 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|