C10H7F5N2O5 — CID 134669717
ethyl 4-(difluoromethyl)-2-nitro-5-(trifluoromethoxy)pyridine-3-carboxylate (PubChem CID 134669717) has the molecular formula C10H7F5N2O5 and a molecular weight of 330.17 g/mol. Its IUPAC name is ethyl 4-(difluoromethyl)-2-nitro-5-(trifluoromethoxy)pyridine-3-carboxylate.
| Compound Name | ethyl 4-(difluoromethyl)-2-nitro-5-(trifluoromethoxy)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134669717 |
| Molecular Formula | C10H7F5N2O5 |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | ethyl 4-(difluoromethyl)-2-nitro-5-(trifluoromethoxy)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c([N+](=O)[O-])ncc(OC(F)(F)F)c1C(F)F |
| InChI | InChI=1S/C10H7F5N2O5/c1-2-21-9(18)6-5(7(11)12)4(22-10(13,14)15)3-16-8(6)17(19)20/h3,7H,2H2,1H3 |
| InChIKey | RKPPWQYFWYNIIY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|