C9H9F2N3O4 — CID 134670512
ethyl 6-amino-4-(difluoromethyl)-3-nitropyridine-2-carboxylate (PubChem CID 134670512) has the molecular formula C9H9F2N3O4 and a molecular weight of 261.18 g/mol. Its IUPAC name is ethyl 6-amino-4-(difluoromethyl)-3-nitropyridine-2-carboxylate.
| Compound Name | ethyl 6-amino-4-(difluoromethyl)-3-nitropyridine-2-carboxylate |
|---|---|
| PubChem CID | 134670512 |
| Molecular Formula | C9H9F2N3O4 |
| Molecular Weight | 261.18 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | ethyl 6-amino-4-(difluoromethyl)-3-nitropyridine-2-carboxylate |
| SMILES | CCOC(=O)c1nc(N)cc(C(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9F2N3O4/c1-2-18-9(15)6-7(14(16)17)4(8(10)11)3-5(12)13-6/h3,8H,2H2,1H3,(H2,12,13) |
| InChIKey | VUXUQQIZRDAOAF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.18 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|