C8H6F5NO — CID 134672402
[3-(difluoromethyl)-5-(trifluoromethyl)-4-pyridinyl]methanol (PubChem CID 134672402) has the molecular formula C8H6F5NO and a molecular weight of 227.13 g/mol. Its IUPAC name is [3-(difluoromethyl)-5-(trifluoromethyl)-4-pyridinyl]methanol.
| Compound Name | [3-(difluoromethyl)-5-(trifluoromethyl)-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 134672402 |
| Molecular Formula | C8H6F5NO |
| Molecular Weight | 227.13 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | [3-(difluoromethyl)-5-(trifluoromethyl)-4-pyridinyl]methanol |
| SMILES | OCc1c(C(F)F)cncc1C(F)(F)F |
| InChI | InChI=1S/C8H6F5NO/c9-7(10)4-1-14-2-6(5(4)3-15)8(11,12)13/h1-2,7,15H,3H2 |
| InChIKey | PCHUWWVFOZDOAF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.13 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |