C8H7F2N3O2S — CID 134672433
4-cyano-5-(difluoromethyl)-2-methylpyridine-3-sulfonamide (PubChem CID 134672433) has the molecular formula C8H7F2N3O2S and a molecular weight of 247.23 g/mol. Its IUPAC name is 4-cyano-5-(difluoromethyl)-2-methylpyridine-3-sulfonamide.
| Compound Name | 4-cyano-5-(difluoromethyl)-2-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 134672433 |
| Molecular Formula | C8H7F2N3O2S |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 4-cyano-5-(difluoromethyl)-2-methylpyridine-3-sulfonamide |
| SMILES | Cc1ncc(C(F)F)c(C#N)c1S(N)(=O)=O |
| InChI | InChI=1S/C8H7F2N3O2S/c1-4-7(16(12,14)15)5(2-11)6(3-13-4)8(9)10/h3,8H,1H3,(H2,12,14,15) |
| InChIKey | PLJCFAICDOGSJV-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 96.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |