C11H12ClF2NO2 — CID 134673525
ethyl 2-[3-(chloromethyl)-6-(difluoromethyl)-2-pyridinyl]acetate (PubChem CID 134673525) has the molecular formula C11H12ClF2NO2 and a molecular weight of 263.67 g/mol. Its IUPAC name is ethyl 2-[3-(chloromethyl)-6-(difluoromethyl)-2-pyridinyl]acetate.
| Compound Name | ethyl 2-[3-(chloromethyl)-6-(difluoromethyl)-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 134673525 |
| Molecular Formula | C11H12ClF2NO2 |
| Molecular Weight | 263.67 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | ethyl 2-[3-(chloromethyl)-6-(difluoromethyl)-2-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1nc(C(F)F)ccc1CCl |
| InChI | InChI=1S/C11H12ClF2NO2/c1-2-17-10(16)5-9-7(6-12)3-4-8(15-9)11(13)14/h3-4,11H,2,5-6H2,1H3 |
| InChIKey | UKZTZUVAVPXNPN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.67 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|