About N-butyl-1,1-diphenylmethanimine
N-butyl-1,1-diphenylmethanimine (PubChem CID 13467390) has the molecular formula C17H19N
and a molecular weight of 237.35 g/mol. Its IUPAC name is N-butyl-1,1-diphenylmethanimine.
Molecular Properties
| Compound Name | N-butyl-1,1-diphenylmethanimine |
| PubChem CID | 13467390 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | N-butyl-1,1-diphenylmethanimine |
| SMILES | CCCCN=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19N/c1-2-3-14-18-17(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13H,2-3,14H2,1H3 |
| InChIKey | GBUGOMNAHRJNFV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-1,1-diphenylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-1,1-diphenylmethanimine?
The IUPAC name of N-butyl-1,1-diphenylmethanimine (CID 13467390) is N-butyl-1,1-diphenylmethanimine.
What is the SMILES notation for N-butyl-1,1-diphenylmethanimine?
The canonical SMILES for N-butyl-1,1-diphenylmethanimine is CCCCN=C(c1ccccc1)c1ccccc1.
What is the InChIKey of N-butyl-1,1-diphenylmethanimine?
The InChIKey is GBUGOMNAHRJNFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N/c1-2-3-14-18-17(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13H,2-3,14H2,1H3.
What are the key properties of N-butyl-1,1-diphenylmethanimine?
N-butyl-1,1-diphenylmethanimine has a molecular weight of 237.35 g/mol, XLogP of 4.32, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-1,1-diphenylmethanimine is sourced from PubChem (CID 13467390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).