C10H7ClF2N2O2 — CID 134674118
methyl 2-[3-chloro-2-cyano-5-(difluoromethyl)-4-pyridinyl]acetate (PubChem CID 134674118) has the molecular formula C10H7ClF2N2O2 and a molecular weight of 260.63 g/mol. Its IUPAC name is methyl 2-[3-chloro-2-cyano-5-(difluoromethyl)-4-pyridinyl]acetate.
| Compound Name | methyl 2-[3-chloro-2-cyano-5-(difluoromethyl)-4-pyridinyl]acetate |
|---|---|
| PubChem CID | 134674118 |
| Molecular Formula | C10H7ClF2N2O2 |
| Molecular Weight | 260.63 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | methyl 2-[3-chloro-2-cyano-5-(difluoromethyl)-4-pyridinyl]acetate |
| SMILES | COC(=O)Cc1c(C(F)F)cnc(C#N)c1Cl |
| InChI | InChI=1S/C10H7ClF2N2O2/c1-17-8(16)2-5-6(10(12)13)4-15-7(3-14)9(5)11/h4,10H,2H2,1H3 |
| InChIKey | DLHKWXITDDBQBH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.63 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |