C9H5BrF5NO2 — CID 134674291
methyl 4-bromo-5-(difluoromethyl)-3-(trifluoromethyl)pyridine-2-carboxylate (PubChem CID 134674291) has the molecular formula C9H5BrF5NO2 and a molecular weight of 334.04 g/mol. Its IUPAC name is methyl 4-bromo-5-(difluoromethyl)-3-(trifluoromethyl)pyridine-2-carboxylate.
| Compound Name | methyl 4-bromo-5-(difluoromethyl)-3-(trifluoromethyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134674291 |
| Molecular Formula | C9H5BrF5NO2 |
| Molecular Weight | 334.04 g/mol |
| Exact Mass | 332.94 |
| IUPAC Name | methyl 4-bromo-5-(difluoromethyl)-3-(trifluoromethyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ncc(C(F)F)c(Br)c1C(F)(F)F |
| InChI | InChI=1S/C9H5BrF5NO2/c1-18-8(17)6-4(9(13,14)15)5(10)3(2-16-6)7(11)12/h2,7H,1H3 |
| InChIKey | DEKDJBIOENTVDL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.04 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |