C10H11BrF2N2O2 — CID 134675985
ethyl 5-(aminomethyl)-6-bromo-4-(difluoromethyl)pyridine-2-carboxylate (PubChem CID 134675985) has the molecular formula C10H11BrF2N2O2 and a molecular weight of 309.11 g/mol. Its IUPAC name is ethyl 5-(aminomethyl)-6-bromo-4-(difluoromethyl)pyridine-2-carboxylate.
| Compound Name | ethyl 5-(aminomethyl)-6-bromo-4-(difluoromethyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134675985 |
| Molecular Formula | C10H11BrF2N2O2 |
| Molecular Weight | 309.11 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | ethyl 5-(aminomethyl)-6-bromo-4-(difluoromethyl)pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc(C(F)F)c(CN)c(Br)n1 |
| InChI | InChI=1S/C10H11BrF2N2O2/c1-2-17-10(16)7-3-5(9(12)13)6(4-14)8(11)15-7/h3,9H,2,4,14H2,1H3 |
| InChIKey | OLIBBKFJZSPNFN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.11 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|