C8H4F3IN2O5 — CID 134676198
2-[2-iodo-3-nitro-6-(trifluoromethoxy)-4-pyridinyl]acetic acid (PubChem CID 134676198) has the molecular formula C8H4F3IN2O5 and a molecular weight of 392.03 g/mol. Its IUPAC name is 2-[2-iodo-3-nitro-6-(trifluoromethoxy)-4-pyridinyl]acetic acid.
| Compound Name | 2-[2-iodo-3-nitro-6-(trifluoromethoxy)-4-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134676198 |
| Molecular Formula | C8H4F3IN2O5 |
| Molecular Weight | 392.03 g/mol |
| Exact Mass | 391.91 |
| IUPAC Name | 2-[2-iodo-3-nitro-6-(trifluoromethoxy)-4-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1cc(OC(F)(F)F)nc(I)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H4F3IN2O5/c9-8(10,11)19-4-1-3(2-5(15)16)6(14(17)18)7(12)13-4/h1H,2H2,(H,15,16) |
| InChIKey | LLNAGYQWQKFXEW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.03 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|