C10H9Cl2F2NO2 — CID 134676981
ethyl 2-[4,5-dichloro-6-(difluoromethyl)-3-pyridinyl]acetate (PubChem CID 134676981) has the molecular formula C10H9Cl2F2NO2 and a molecular weight of 284.09 g/mol. Its IUPAC name is ethyl 2-[4,5-dichloro-6-(difluoromethyl)-3-pyridinyl]acetate.
| Compound Name | ethyl 2-[4,5-dichloro-6-(difluoromethyl)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 134676981 |
| Molecular Formula | C10H9Cl2F2NO2 |
| Molecular Weight | 284.09 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | ethyl 2-[4,5-dichloro-6-(difluoromethyl)-3-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1cnc(C(F)F)c(Cl)c1Cl |
| InChI | InChI=1S/C10H9Cl2F2NO2/c1-2-17-6(16)3-5-4-15-9(10(13)14)8(12)7(5)11/h4,10H,2-3H2,1H3 |
| InChIKey | IGBOVBDUVOQNMH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.09 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |