C9H7F4NO2 — CID 134677162
ethyl 5-(difluoromethyl)-2,6-difluoropyridine-3-carboxylate (PubChem CID 134677162) has the molecular formula C9H7F4NO2 and a molecular weight of 237.15 g/mol. Its IUPAC name is ethyl 5-(difluoromethyl)-2,6-difluoropyridine-3-carboxylate.
| Compound Name | ethyl 5-(difluoromethyl)-2,6-difluoropyridine-3-carboxylate |
|---|---|
| PubChem CID | 134677162 |
| Molecular Formula | C9H7F4NO2 |
| Molecular Weight | 237.15 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | ethyl 5-(difluoromethyl)-2,6-difluoropyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C(F)F)c(F)nc1F |
| InChI | InChI=1S/C9H7F4NO2/c1-2-16-9(15)5-3-4(6(10)11)7(12)14-8(5)13/h3,6H,2H2,1H3 |
| InChIKey | OUUJVUFHKYYWCM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.15 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|