About 7a-methyl-5,6-dihydroindene-1,7-dione
7a-methyl-5,6-dihydroindene-1,7-dione (PubChem CID 13467762) has the molecular formula C10H10O2
and a molecular weight of 162.19 g/mol. Its IUPAC name is 7a-methyl-5,6-dihydroindene-1,7-dione.
Molecular Properties
| Compound Name | 7a-methyl-5,6-dihydroindene-1,7-dione |
| PubChem CID | 13467762 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 7a-methyl-5,6-dihydroindene-1,7-dione |
| SMILES | CC12C(=O)C=CC1=CCCC2=O |
| InChI | InChI=1S/C10H10O2/c1-10-7(5-6-9(10)12)3-2-4-8(10)11/h3,5-6H,2,4H2,1H3 |
| InChIKey | KLPCWZOGDNASKO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 7a-methyl-5,6-dihydroindene-1,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7a-methyl-5,6-dihydroindene-1,7-dione?
The IUPAC name of 7a-methyl-5,6-dihydroindene-1,7-dione (CID 13467762) is 7a-methyl-5,6-dihydroindene-1,7-dione.
What is the SMILES notation for 7a-methyl-5,6-dihydroindene-1,7-dione?
The canonical SMILES for 7a-methyl-5,6-dihydroindene-1,7-dione is CC12C(=O)C=CC1=CCCC2=O.
What is the InChIKey of 7a-methyl-5,6-dihydroindene-1,7-dione?
The InChIKey is KLPCWZOGDNASKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2/c1-10-7(5-6-9(10)12)3-2-4-8(10)11/h3,5-6H,2,4H2,1H3.
What are the key properties of 7a-methyl-5,6-dihydroindene-1,7-dione?
7a-methyl-5,6-dihydroindene-1,7-dione has a molecular weight of 162.19 g/mol, XLogP of 1.42, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7a-methyl-5,6-dihydroindene-1,7-dione is sourced from PubChem (CID 13467762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).