About 5,6-dimethyl-2-oxo-1H-pyridine-3,4-dicarbonitrile
5,6-dimethyl-2-oxo-1H-pyridine-3,4-dicarbonitrile (PubChem CID 13468039) has the molecular formula C9H7N3O
and a molecular weight of 173.17 g/mol. Its IUPAC name is 5,6-dimethyl-2-oxo-1H-pyridine-3,4-dicarbonitrile.
Molecular Properties
| Compound Name | 5,6-dimethyl-2-oxo-1H-pyridine-3,4-dicarbonitrile |
| PubChem CID | 13468039 |
| Molecular Formula | C9H7N3O |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 5,6-dimethyl-2-oxo-1H-pyridine-3,4-dicarbonitrile |
| SMILES | Cc1[nH]c(=O)c(C#N)c(C#N)c1C |
| InChI | InChI=1S/C9H7N3O/c1-5-6(2)12-9(13)8(4-11)7(5)3-10/h1-2H3,(H,12,13) |
| InChIKey | IVKANFWPHAKRRJ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,6-dimethyl-2-oxo-1H-pyridine-3,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-2-oxo-1H-pyridine-3,4-dicarbonitrile?
The IUPAC name of 5,6-dimethyl-2-oxo-1H-pyridine-3,4-dicarbonitrile (CID 13468039) is 5,6-dimethyl-2-oxo-1H-pyridine-3,4-dicarbonitrile.
What is the SMILES notation for 5,6-dimethyl-2-oxo-1H-pyridine-3,4-dicarbonitrile?
The canonical SMILES for 5,6-dimethyl-2-oxo-1H-pyridine-3,4-dicarbonitrile is Cc1[nH]c(=O)c(C#N)c(C#N)c1C.
What is the InChIKey of 5,6-dimethyl-2-oxo-1H-pyridine-3,4-dicarbonitrile?
The InChIKey is IVKANFWPHAKRRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O/c1-5-6(2)12-9(13)8(4-11)7(5)3-10/h1-2H3,(H,12,13).
What are the key properties of 5,6-dimethyl-2-oxo-1H-pyridine-3,4-dicarbonitrile?
5,6-dimethyl-2-oxo-1H-pyridine-3,4-dicarbonitrile has a molecular weight of 173.17 g/mol, XLogP of 0.74, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-2-oxo-1H-pyridine-3,4-dicarbonitrile is sourced from PubChem (CID 13468039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).